ChemNet > CAS > 118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
Nazwa produktu: |
2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one |
Synonimy |
2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone; 2-bromo-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
MF |
C11H8BrClOS |
Masie cząsteczkowej |
303.6026 |
InChI |
InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
Nr CAS |
118337-33-0 |
Struktury molekularnej |
|
Gęstość |
1.632g/cm3 |
Temperatura topnienia |
94℃ |
Temperatura wrzenia |
396.2°C at 760 mmHg |
Współczynnik załamania |
1.676 |
Temperatura zapłonu |
193.4°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|